C30H39N3O9S2 — CID 91299040
[(3S,4R,6S)-2-(azidomethyl)-3-hydroxy-5-methyl-6-methylsulfanyloxan-4-yl] benzoate;[(3S,4R,6S)-3-hydroxy-2-(hydroxymethyl)-5-methyl-6-methylsulfanyloxan-4-yl] benzoate (PubChem CID 91299040) has the molecular formula C30H39N3O9S2 and a molecular weight of 649.79 g/mol. Its IUPAC name is [(3S,4R,6S)-2-(azidomethyl)-3-hydroxy-5-methyl-6-methylsulfanyloxan-4-yl] benzoate;[(3S,4R,6S)-3-hydroxy-2-(hydroxymethyl)-5-methyl-6-methylsulfanyloxan-4-yl] benzoate.
| Compound Name | [(3S,4R,6S)-2-(azidomethyl)-3-hydroxy-5-methyl-6-methylsulfanyloxan-4-yl] benzoate;[(3S,4R,6S)-3-hydroxy-2-(hydroxymethyl)-5-methyl-6-methylsulfanyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 91299040 |
| Molecular Formula | C30H39N3O9S2 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.21 |
| IUPAC Name | [(3S,4R,6S)-2-(azidomethyl)-3-hydroxy-5-methyl-6-methylsulfanyloxan-4-yl] benzoate;[(3S,4R,6S)-3-hydroxy-2-(hydroxymethyl)-5-methyl-6-methylsulfanyloxan-4-yl] benzoate |
| SMILES | CS[C@@H]1OC(CN=[N+]=[N-])[C@@H](O)[C@H](OC(=O)c2ccccc2)C1C.CS[C@@H]1OC(CO)[C@@H](O)[C@H](OC(=O)c2ccccc2)C1C |
| InChI | InChI=1S/C15H19N3O4S.C15H20O5S/c1-9-13(22-14(20)10-6-4-3-5-7-10)12(19)11(8-17-18-16)21-15(9)23-2;1-9-13(12(17)11(8-16)19-15(9)21-2)20-14(18)10-6-4-3-5-7-10/h3-7,9,11-13,15,19H,8H2,1-2H3;3-7,9,11-13,15-17H,8H2,1-2H3/t2*9?,11?,12-,13-,15+/m11/s1 |
| InChIKey | QMHVORAOAMNLKP-QSFPCCIUSA-N |
| XLogP | 3.90 |
| TPSA | 180.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|