C18H21N3O8 — CID 4317109
[4,5-diacetyloxy-2-(azidomethyl)-6-methoxyoxan-3-yl] benzoate (PubChem CID 4317109) has the molecular formula C18H21N3O8 and a molecular weight of 407.38 g/mol. Its IUPAC name is [4,5-diacetyloxy-2-(azidomethyl)-6-methoxyoxan-3-yl] benzoate.
| Compound Name | [4,5-diacetyloxy-2-(azidomethyl)-6-methoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 4317109 |
| Molecular Formula | C18H21N3O8 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [4,5-diacetyloxy-2-(azidomethyl)-6-methoxyoxan-3-yl] benzoate |
| SMILES | COC1OC(CN=[N+]=[N-])C(OC(=O)c2ccccc2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H21N3O8/c1-10(22)26-15-14(29-17(24)12-7-5-4-6-8-12)13(9-20-21-19)28-18(25-3)16(15)27-11(2)23/h4-8,13-16,18H,9H2,1-3H3 |
| InChIKey | IYBYLAJBTFZVDV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|