C20H21N3O5S — CID 102030801
[(2R,3R,4R,5S)-2-(azidomethyl)-4-methoxy-5-(4-methylphenyl)sulfanyloxyoxolan-3-yl] benzoate (PubChem CID 102030801) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2-(azidomethyl)-4-methoxy-5-(4-methylphenyl)sulfanyloxyoxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5S)-2-(azidomethyl)-4-methoxy-5-(4-methylphenyl)sulfanyloxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 102030801 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [(2R,3R,4R,5S)-2-(azidomethyl)-4-methoxy-5-(4-methylphenyl)sulfanyloxyoxolan-3-yl] benzoate |
| SMILES | CO[C@H]1[C@H](OSc2ccc(C)cc2)O[C@H](CN=[N+]=[N-])[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O5S/c1-13-8-10-15(11-9-13)29-28-20-18(25-2)17(16(26-20)12-22-23-21)27-19(24)14-6-4-3-5-7-14/h3-11,16-18,20H,12H2,1-2H3/t16-,17-,18-,20+/m1/s1 |
| InChIKey | ZFIQFXDTJVBODD-MLYOOKFZSA-N |
| XLogP | 4.29 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|