C16H22N4O7S — CID 45050103
[(3S)-2-(azidomethyl)-5-benzamido-4,6-dimethoxyoxan-3-yl] methanesulfonate (PubChem CID 45050103) has the molecular formula C16H22N4O7S and a molecular weight of 414.44 g/mol. Its IUPAC name is [(3S)-2-(azidomethyl)-5-benzamido-4,6-dimethoxyoxan-3-yl] methanesulfonate.
| Compound Name | [(3S)-2-(azidomethyl)-5-benzamido-4,6-dimethoxyoxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 45050103 |
| Molecular Formula | C16H22N4O7S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [(3S)-2-(azidomethyl)-5-benzamido-4,6-dimethoxyoxan-3-yl] methanesulfonate |
| SMILES | COC1OC(CN=[N+]=[N-])[C@H](OS(C)(=O)=O)C(OC)C1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22N4O7S/c1-24-14-12(19-15(21)10-7-5-4-6-8-10)16(25-2)26-11(9-18-20-17)13(14)27-28(3,22)23/h4-8,11-14,16H,9H2,1-3H3,(H,19,21)/t11?,12?,13-,14?,16?/m0/s1 |
| InChIKey | GSSSZKORNYDCCM-JMGALGLOSA-N |
| XLogP | 0.83 |
| TPSA | 148.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|