C15H18N4O6S — CID 39355205
[(3aR,4R,6R,7R,7aS)-6-(azidomethyl)-4-methoxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-7-yl] methanesulfonate (PubChem CID 39355205) has the molecular formula C15H18N4O6S and a molecular weight of 382.40 g/mol. Its IUPAC name is [(3aR,4R,6R,7R,7aS)-6-(azidomethyl)-4-methoxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-7-yl] methanesulfonate.
| Compound Name | [(3aR,4R,6R,7R,7aS)-6-(azidomethyl)-4-methoxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 39355205 |
| Molecular Formula | C15H18N4O6S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [(3aR,4R,6R,7R,7aS)-6-(azidomethyl)-4-methoxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-7-yl] methanesulfonate |
| SMILES | CO[C@@H]1O[C@H](CN=[N+]=[N-])[C@@H](OS(C)(=O)=O)[C@H]2OC(c3ccccc3)=N[C@@H]12 |
| InChI | InChI=1S/C15H18N4O6S/c1-22-15-11-13(24-14(18-11)9-6-4-3-5-7-9)12(25-26(2,20)21)10(23-15)8-17-19-16/h3-7,10-13,15H,8H2,1-2H3/t10-,11-,12-,13+,15-/m1/s1 |
| InChIKey | DIKMJWMRYYETRX-XLFUENPSSA-N |
| XLogP | 1.23 |
| TPSA | 132.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|