C15H19N7O6S — CID 4264128
[4-azido-2-(azidomethyl)-5-benzamido-6-methoxyoxan-3-yl] methanesulfonate (PubChem CID 4264128) has the molecular formula C15H19N7O6S and a molecular weight of 425.43 g/mol. Its IUPAC name is [4-azido-2-(azidomethyl)-5-benzamido-6-methoxyoxan-3-yl] methanesulfonate.
| Compound Name | [4-azido-2-(azidomethyl)-5-benzamido-6-methoxyoxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 4264128 |
| Molecular Formula | C15H19N7O6S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [4-azido-2-(azidomethyl)-5-benzamido-6-methoxyoxan-3-yl] methanesulfonate |
| SMILES | COC1OC(CN=[N+]=[N-])C(OS(C)(=O)=O)C(N=[N+]=[N-])C1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19N7O6S/c1-26-15-12(19-14(23)9-6-4-3-5-7-9)11(20-22-17)13(28-29(2,24)25)10(27-15)8-18-21-16/h3-7,10-13,15H,8H2,1-2H3,(H,19,23) |
| InChIKey | HMEOJLHSNFGTKQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 188.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|