C23H28N2O8S — CID 44725237
[2-benzamido-1-[(2S,3R,4R,5R)-4-benzamido-3,5-dimethoxyoxolan-2-yl]ethyl] methanesulfonate (PubChem CID 44725237) has the molecular formula C23H28N2O8S and a molecular weight of 492.55 g/mol. Its IUPAC name is [2-benzamido-1-[(2S,3R,4R,5R)-4-benzamido-3,5-dimethoxyoxolan-2-yl]ethyl] methanesulfonate.
| Compound Name | [2-benzamido-1-[(2S,3R,4R,5R)-4-benzamido-3,5-dimethoxyoxolan-2-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 44725237 |
| Molecular Formula | C23H28N2O8S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [2-benzamido-1-[(2S,3R,4R,5R)-4-benzamido-3,5-dimethoxyoxolan-2-yl]ethyl] methanesulfonate |
| SMILES | CO[C@@H]1O[C@H](C(CNC(=O)c2ccccc2)OS(C)(=O)=O)[C@H](OC)[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O8S/c1-30-20-18(25-22(27)16-12-8-5-9-13-16)23(31-2)32-19(20)17(33-34(3,28)29)14-24-21(26)15-10-6-4-7-11-15/h4-13,17-20,23H,14H2,1-3H3,(H,24,26)(H,25,27)/t17?,18-,19-,20-,23-/m1/s1 |
| InChIKey | PFNZAXDUNVOOLI-VMBZSWGWSA-N |
| XLogP | 0.95 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|