C28H29NO8S — CID 98548450
[(2S,4aS,6S,7R,8R,8aS)-7-benzamido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate (PubChem CID 98548450) has the molecular formula C28H29NO8S and a molecular weight of 539.61 g/mol. Its IUPAC name is [(2S,4aS,6S,7R,8R,8aS)-7-benzamido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,4aS,6S,7R,8R,8aS)-7-benzamido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 98548450 |
| Molecular Formula | C28H29NO8S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | [(2S,4aS,6S,7R,8R,8aS)-7-benzamido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate |
| SMILES | CO[C@H]1O[C@H]2CO[C@H](c3ccccc3)O[C@@H]2[C@H](OS(=O)(=O)c2ccc(C)cc2)[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H29NO8S/c1-18-13-15-21(16-14-18)38(31,32)37-25-23(29-26(30)19-9-5-3-6-10-19)28(33-2)35-22-17-34-27(36-24(22)25)20-11-7-4-8-12-20/h3-16,22-25,27-28H,17H2,1-2H3,(H,29,30)/t22-,23+,24-,25+,27-,28-/m0/s1 |
| InChIKey | OHJDMCARBLDQHA-KLPWJXDZSA-N |
| XLogP | 3.35 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|