C24H31NO6S — CID 44634347
(2R,4aR,6S,7S,8R,8aR)-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-N-propan-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine (PubChem CID 44634347) has the molecular formula C24H31NO6S and a molecular weight of 461.58 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-N-propan-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-N-propan-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
|---|---|
| PubChem CID | 44634347 |
| Molecular Formula | C24H31NO6S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-N-propan-2-yl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](S(=O)(=O)c2ccc(C)cc2)[C@H]1NC(C)C |
| InChI | InChI=1S/C24H31NO6S/c1-15(2)25-20-22(32(26,27)18-12-10-16(3)11-13-18)21-19(30-24(20)28-4)14-29-23(31-21)17-8-6-5-7-9-17/h5-13,15,19-25H,14H2,1-4H3/t19-,20-,21-,22-,23-,24+/m1/s1 |
| InChIKey | JKBUFCFDTSPPIH-QALHXSLCSA-N |
| XLogP | 2.99 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |