C17H23NO7S2 — CID 51063376
S-[(4aR,6R,7S,8R,8aR)-7-(methanesulfonamido)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] ethanethioate (PubChem CID 51063376) has the molecular formula C17H23NO7S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is S-[(4aR,6R,7S,8R,8aR)-7-(methanesulfonamido)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] ethanethioate.
| Compound Name | S-[(4aR,6R,7S,8R,8aR)-7-(methanesulfonamido)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] ethanethioate |
|---|---|
| PubChem CID | 51063376 |
| Molecular Formula | C17H23NO7S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | S-[(4aR,6R,7S,8R,8aR)-7-(methanesulfonamido)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] ethanethioate |
| SMILES | CO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](SC(C)=O)[C@H]1NS(C)(=O)=O |
| InChI | InChI=1S/C17H23NO7S2/c1-10(19)26-15-13(18-27(3,20)21)17(22-2)24-12-9-23-16(25-14(12)15)11-7-5-4-6-8-11/h4-8,12-18H,9H2,1-3H3/t12-,13-,14-,15-,16?,17-/m1/s1 |
| InChIKey | BTCFQLRHZMYYPE-CTEFGONOSA-N |
| XLogP | 1.04 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|