C16H24N2O7S — CID 3455692
[2-(aminomethyl)-5-benzamido-4,6-dimethoxyoxan-3-yl] methanesulfonate (PubChem CID 3455692) has the molecular formula C16H24N2O7S and a molecular weight of 388.44 g/mol. Its IUPAC name is [2-(aminomethyl)-5-benzamido-4,6-dimethoxyoxan-3-yl] methanesulfonate.
| Compound Name | [2-(aminomethyl)-5-benzamido-4,6-dimethoxyoxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 3455692 |
| Molecular Formula | C16H24N2O7S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [2-(aminomethyl)-5-benzamido-4,6-dimethoxyoxan-3-yl] methanesulfonate |
| SMILES | COC1OC(CN)C(OS(C)(=O)=O)C(OC)C1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O7S/c1-22-14-12(18-15(19)10-7-5-4-6-8-10)16(23-2)24-11(9-17)13(14)25-26(3,20)21/h4-8,11-14,16H,9,17H2,1-3H3,(H,18,19) |
| InChIKey | DFDNDTSGSUBKDG-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|