C15H21NO9S2 — CID 98535617
[(2S,3R,4R,5R)-5-benzamido-2-methoxy-3-methylsulfonyloxyoxan-4-yl] methanesulfonate (PubChem CID 98535617) has the molecular formula C15H21NO9S2 and a molecular weight of 423.47 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-benzamido-2-methoxy-3-methylsulfonyloxyoxan-4-yl] methanesulfonate.
| Compound Name | [(2S,3R,4R,5R)-5-benzamido-2-methoxy-3-methylsulfonyloxyoxan-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 98535617 |
| Molecular Formula | C15H21NO9S2 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | [(2S,3R,4R,5R)-5-benzamido-2-methoxy-3-methylsulfonyloxyoxan-4-yl] methanesulfonate |
| SMILES | CO[C@H]1OC[C@@H](NC(=O)c2ccccc2)[C@@H](OS(C)(=O)=O)[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C15H21NO9S2/c1-22-15-13(25-27(3,20)21)12(24-26(2,18)19)11(9-23-15)16-14(17)10-7-5-4-6-8-10/h4-8,11-13,15H,9H2,1-3H3,(H,16,17)/t11-,12-,13-,15+/m1/s1 |
| InChIKey | UWDUPLJVBOJTCD-BHPKHCPMSA-N |
| XLogP | -0.52 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|