C21H23NO6 — CID 154508738
[(2R,3R,4S,6S)-4-benzamido-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzoate (PubChem CID 154508738) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is [(2R,3R,4S,6S)-4-benzamido-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,6S)-4-benzamido-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 154508738 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | [(2R,3R,4S,6S)-4-benzamido-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzoate |
| SMILES | CO[C@@H]1O[C@H](CO)C[C@H](NC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23NO6/c1-26-21-18(28-20(25)15-10-6-3-7-11-15)17(12-16(13-23)27-21)22-19(24)14-8-4-2-5-9-14/h2-11,16-18,21,23H,12-13H2,1H3,(H,22,24)/t16-,17-,18+,21+/m0/s1 |
| InChIKey | QIIXYZQFJMCPFB-LXGFNABISA-N |
| XLogP | 1.76 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |