C15H20N4O7S — CID 92840871
[(2S,3R,4R,5S,6S)-2-(azidomethyl)-5-benzamido-3-hydroxy-6-methoxyoxan-4-yl] methanesulfonate (PubChem CID 92840871) has the molecular formula C15H20N4O7S and a molecular weight of 400.41 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-2-(azidomethyl)-5-benzamido-3-hydroxy-6-methoxyoxan-4-yl] methanesulfonate.
| Compound Name | [(2S,3R,4R,5S,6S)-2-(azidomethyl)-5-benzamido-3-hydroxy-6-methoxyoxan-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 92840871 |
| Molecular Formula | C15H20N4O7S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-2-(azidomethyl)-5-benzamido-3-hydroxy-6-methoxyoxan-4-yl] methanesulfonate |
| SMILES | CO[C@H]1O[C@@H](CN=[N+]=[N-])[C@@H](O)[C@H](OS(C)(=O)=O)[C@@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20N4O7S/c1-24-15-11(18-14(21)9-6-4-3-5-7-9)13(26-27(2,22)23)12(20)10(25-15)8-17-19-16/h3-7,10-13,15,20H,8H2,1-2H3,(H,18,21)/t10-,11-,12+,13+,15-/m0/s1 |
| InChIKey | SCJGVVPELCLEBM-WHPHWUKISA-N |
| XLogP | 0.17 |
| TPSA | 159.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|