C22H24N8O4 — CID 92842695
N-[(2R,3R,4S,5R,6R)-5-acetamido-3-azido-2-(azidomethyl)-6-phenylmethoxyoxan-4-yl]benzamide (PubChem CID 92842695) has the molecular formula C22H24N8O4 and a molecular weight of 464.49 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R,6R)-5-acetamido-3-azido-2-(azidomethyl)-6-phenylmethoxyoxan-4-yl]benzamide.
| Compound Name | N-[(2R,3R,4S,5R,6R)-5-acetamido-3-azido-2-(azidomethyl)-6-phenylmethoxyoxan-4-yl]benzamide |
|---|---|
| PubChem CID | 92842695 |
| Molecular Formula | C22H24N8O4 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-[(2R,3R,4S,5R,6R)-5-acetamido-3-azido-2-(azidomethyl)-6-phenylmethoxyoxan-4-yl]benzamide |
| SMILES | CC(=O)N[C@H]1[C@H](OCc2ccccc2)O[C@H](CN=[N+]=[N-])[C@H](N=[N+]=[N-])[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N8O4/c1-14(31)26-20-19(27-21(32)16-10-6-3-7-11-16)18(28-30-24)17(12-25-29-23)34-22(20)33-13-15-8-4-2-5-9-15/h2-11,17-20,22H,12-13H2,1H3,(H,26,31)(H,27,32)/t17-,18+,19-,20-,22-/m1/s1 |
| InChIKey | SPFNVFAVFSPQCN-AIYVTKCESA-N |
| XLogP | 3.22 |
| TPSA | 174.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|