C15H21NO9S — CID 132520647
[(2R,3S,4S,5R,6R)-5-acetamido-3,4-dihydroxy-6-phenylmethoxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 132520647) has the molecular formula C15H21NO9S and a molecular weight of 391.40 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5-acetamido-3,4-dihydroxy-6-phenylmethoxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2R,3S,4S,5R,6R)-5-acetamido-3,4-dihydroxy-6-phenylmethoxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 132520647 |
| Molecular Formula | C15H21NO9S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5-acetamido-3,4-dihydroxy-6-phenylmethoxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | CC(=O)N[C@H]1[C@H](OCc2ccccc2)O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H21NO9S/c1-9(17)16-12-14(19)13(18)11(8-24-26(20,21)22)25-15(12)23-7-10-5-3-2-4-6-10/h2-6,11-15,18-19H,7-8H2,1H3,(H,16,17)(H,20,21,22)/t11-,12-,13-,14+,15-/m1/s1 |
| InChIKey | SIHNNFZVEAKYRN-ARILJUKYSA-N |
| XLogP | -1.03 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|