C16H23NO8S — CID 125029876
[(2R,3S,4R,5S,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-yl] methanesulfonate (PubChem CID 125029876) has the molecular formula C16H23NO8S and a molecular weight of 389.43 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-yl] methanesulfonate.
| Compound Name | [(2R,3S,4R,5S,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 125029876 |
| Molecular Formula | C16H23NO8S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-yl] methanesulfonate |
| SMILES | CC(=O)N[C@@H]1[C@H](OCc2ccccc2)O[C@H](CO)[C@@H](OS(C)(=O)=O)[C@@H]1O |
| InChI | InChI=1S/C16H23NO8S/c1-10(19)17-13-14(20)15(25-26(2,21)22)12(8-18)24-16(13)23-9-11-6-4-3-5-7-11/h3-7,12-16,18,20H,8-9H2,1-2H3,(H,17,19)/t12-,13+,14-,15-,16-/m1/s1 |
| InChIKey | YFFGUILUCDKECD-YIDVYQOGSA-N |
| XLogP | -0.87 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|