C14H19NO9S — CID 11718152
[(2R,3R,4R,5R,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-phenoxyoxan-3-yl] hydrogen sulfate (PubChem CID 11718152) has the molecular formula C14H19NO9S and a molecular weight of 377.37 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-phenoxyoxan-3-yl] hydrogen sulfate.
| Compound Name | [(2R,3R,4R,5R,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-phenoxyoxan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 11718152 |
| Molecular Formula | C14H19NO9S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-phenoxyoxan-3-yl] hydrogen sulfate |
| SMILES | CC(=O)N[C@H]1[C@@H](Oc2ccccc2)O[C@H](CO)[C@H](OS(=O)(=O)O)[C@@H]1O |
| InChI | InChI=1S/C14H19NO9S/c1-8(17)15-11-12(18)13(24-25(19,20)21)10(7-16)23-14(11)22-9-5-3-2-4-6-9/h2-6,10-14,16,18H,7H2,1H3,(H,15,17)(H,19,20,21)/t10-,11-,12-,13+,14+/m1/s1 |
| InChIKey | PQEKRLIMCKOUDG-POQQGIQPSA-N |
| XLogP | -1.16 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|