C15H20NO10S- — CID 58658706
[(3R,4R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxan-3-yl] sulfate (PubChem CID 58658706) has the molecular formula C15H20NO10S- and a molecular weight of 406.39 g/mol. Its IUPAC name is [(3R,4R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxan-3-yl] sulfate.
| Compound Name | [(3R,4R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxan-3-yl] sulfate |
|---|---|
| PubChem CID | 58658706 |
| Molecular Formula | C15H20NO10S- |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [(3R,4R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxan-3-yl] sulfate |
| SMILES | COc1ccc(OC2OC(CO)[C@H](OS(=O)(=O)[O-])[C@H](O)C2NC(C)=O)cc1 |
| InChI | InChI=1S/C15H21NO10S/c1-8(18)16-12-13(19)14(26-27(20,21)22)11(7-17)25-15(12)24-10-5-3-9(23-2)4-6-10/h3-6,11-15,17,19H,7H2,1-2H3,(H,16,18)(H,20,21,22)/p-1/t11?,12?,13-,14+,15?/m1/s1 |
| InChIKey | NPLGIEPLURPLAM-HTPHUKHLSA-M |
| XLogP | -1.50 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|