C22H26N2O8S — CID 51055912
[(2R,3R,4R,5R,6R)-4,5-dibenzamido-3-hydroxy-6-methoxyoxan-2-yl]methyl methanesulfonate (PubChem CID 51055912) has the molecular formula C22H26N2O8S and a molecular weight of 478.52 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-4,5-dibenzamido-3-hydroxy-6-methoxyoxan-2-yl]methyl methanesulfonate.
| Compound Name | [(2R,3R,4R,5R,6R)-4,5-dibenzamido-3-hydroxy-6-methoxyoxan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 51055912 |
| Molecular Formula | C22H26N2O8S |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-4,5-dibenzamido-3-hydroxy-6-methoxyoxan-2-yl]methyl methanesulfonate |
| SMILES | CO[C@@H]1O[C@H](COS(C)(=O)=O)[C@H](O)[C@H](NC(=O)c2ccccc2)[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O8S/c1-30-22-18(24-21(27)15-11-7-4-8-12-15)17(23-20(26)14-9-5-3-6-10-14)19(25)16(32-22)13-31-33(2,28)29/h3-12,16-19,22,25H,13H2,1-2H3,(H,23,26)(H,24,27)/t16-,17-,18-,19+,22-/m1/s1 |
| InChIKey | LPASSRWGVYGPAQ-FHRFECMSSA-N |
| XLogP | 0.29 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|