C16H25NO13S4 — CID 98172534
[(2S,3R,4S,5S,6R)-5-(benzenesulfonamido)-6-methoxy-3,4-bis(methylsulfonyloxy)oxan-2-yl]methyl methanesulfonate (PubChem CID 98172534) has the molecular formula C16H25NO13S4 and a molecular weight of 567.64 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-5-(benzenesulfonamido)-6-methoxy-3,4-bis(methylsulfonyloxy)oxan-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,3R,4S,5S,6R)-5-(benzenesulfonamido)-6-methoxy-3,4-bis(methylsulfonyloxy)oxan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 98172534 |
| Molecular Formula | C16H25NO13S4 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.02 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-5-(benzenesulfonamido)-6-methoxy-3,4-bis(methylsulfonyloxy)oxan-2-yl]methyl methanesulfonate |
| SMILES | CO[C@@H]1O[C@@H](COS(C)(=O)=O)[C@@H](OS(C)(=O)=O)[C@@H](OS(C)(=O)=O)[C@@H]1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H25NO13S4/c1-26-16-13(17-34(24,25)11-8-6-5-7-9-11)15(30-33(4,22)23)14(29-32(3,20)21)12(28-16)10-27-31(2,18)19/h5-9,12-17H,10H2,1-4H3/t12-,13-,14+,15-,16+/m0/s1 |
| InChIKey | FMZUCHRCPAWZAM-ARKGTOAJSA-N |
| XLogP | -1.63 |
| TPSA | 194.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|