C9H18O10S2 — CID 124915579
[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-methoxy-5-methylsulfonyloxyoxan-2-yl]methyl methanesulfonate (PubChem CID 124915579) has the molecular formula C9H18O10S2 and a molecular weight of 350.37 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-methoxy-5-methylsulfonyloxyoxan-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-methoxy-5-methylsulfonyloxyoxan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 124915579 |
| Molecular Formula | C9H18O10S2 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-methoxy-5-methylsulfonyloxyoxan-2-yl]methyl methanesulfonate |
| SMILES | CO[C@@H]1O[C@@H](COS(C)(=O)=O)[C@H](O)[C@@H](O)[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C9H18O10S2/c1-16-9-8(19-21(3,14)15)7(11)6(10)5(18-9)4-17-20(2,12)13/h5-11H,4H2,1-3H3/t5-,6-,7+,8-,9+/m0/s1 |
| InChIKey | ORCCABNBLNFISC-VRGHQRLXSA-N |
| XLogP | -2.60 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|