C6H12O7S — CID 174538730
[(3R,4R,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 174538730) has the molecular formula C6H12O7S and a molecular weight of 228.22 g/mol. Its IUPAC name is [(3R,4R,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(3R,4R,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 174538730 |
| Molecular Formula | C6H12O7S |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | [(3R,4R,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1C(O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C6H12O7S/c1-14(10,11)13-5-4(8)3(2-7)12-6(5)9/h3-9H,2H2,1H3/t3-,4-,5-,6?/m1/s1 |
| InChIKey | KKOKNGUCGCXUPY-JDJSBBGDSA-N |
| XLogP | -2.60 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|