C6H10Na2O12S2 — CID 10430079
disodium;[(2R,3S,4S,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-sulfonatooxyoxan-4-yl] sulfate (PubChem CID 10430079) has the molecular formula C6H10Na2O12S2 and a molecular weight of 384.25 g/mol. Its IUPAC name is disodium;[(2R,3S,4S,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-sulfonatooxyoxan-4-yl] sulfate.
| Compound Name | disodium;[(2R,3S,4S,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-sulfonatooxyoxan-4-yl] sulfate |
|---|---|
| PubChem CID | 10430079 |
| Molecular Formula | C6H10Na2O12S2 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | disodium;[(2R,3S,4S,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-sulfonatooxyoxan-4-yl] sulfate |
| SMILES | O=S(=O)([O-])O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](O)[C@H]1OS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H12O12S2.2Na/c7-1-2-3(8)4(17-19(10,11)12)5(6(9)16-2)18-20(13,14)15;;/h2-9H,1H2,(H,10,11,12)(H,13,14,15);;/q;2*+1/p-2/t2-,3-,4+,5+,6-;;/m1../s1 |
| InChIKey | KPXPEWGPVDIZGY-ATVZWOOISA-L |
| XLogP | -10.24 |
| TPSA | 202.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | -10.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|