C6H11NO11S2-2 — CID 171149395
[(2R,3R,4R,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-(sulfonatoamino)oxan-4-yl] sulfate (PubChem CID 171149395) has the molecular formula C6H11NO11S2-2 and a molecular weight of 337.28 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-(sulfonatoamino)oxan-4-yl] sulfate.
| Compound Name | [(2R,3R,4R,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-(sulfonatoamino)oxan-4-yl] sulfate |
|---|---|
| PubChem CID | 171149395 |
| Molecular Formula | C6H11NO11S2-2 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-(sulfonatoamino)oxan-4-yl] sulfate |
| SMILES | O=S(=O)([O-])N[C@@H]1[C@@H](OS(=O)(=O)[O-])[C@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C6H13NO11S2/c8-1-2-4(9)5(18-20(14,15)16)3(6(10)17-2)7-19(11,12)13/h2-10H,1H2,(H,11,12,13)(H,14,15,16)/p-2/t2-,3-,4-,5-,6-/m1/s1 |
| InChIKey | AJBMJMMLWNUEAC-QZABAPFNSA-L |
| XLogP | -4.68 |
| TPSA | 205.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | -4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|