C6H12NNaO8S — CID 56923620
sodium N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]sulfamate (PubChem CID 56923620) has the molecular formula C6H12NNaO8S and a molecular weight of 281.22 g/mol. Its IUPAC name is sodium N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]sulfamate.
| Compound Name | sodium N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]sulfamate |
|---|---|
| PubChem CID | 56923620 |
| Molecular Formula | C6H12NNaO8S |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | sodium N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]sulfamate |
| SMILES | O=S(=O)([O-])N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O.[Na+] |
| InChI | InChI=1S/C6H13NO8S.Na/c8-1-2-4(9)5(10)3(6(11)15-2)7-16(12,13)14;/h2-11H,1H2,(H,12,13,14);/q;+1/p-1/t2-,3-,4-,5-,6-;/m1./s1 |
| InChIKey | WFTBTPAPJHFBJM-OCOFDJSDSA-M |
| XLogP | -7.16 |
| TPSA | 159.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | -7.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|