C9H19NO8S — CID 59771520
3-[[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]propane-1-sulfonic acid (PubChem CID 59771520) has the molecular formula C9H19NO8S and a molecular weight of 301.32 g/mol. Its IUPAC name is 3-[[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59771520 |
| Molecular Formula | C9H19NO8S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-[[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNC1C(O)OC(CO)C(O)C1O |
| InChI | InChI=1S/C9H19NO8S/c11-4-5-7(12)8(13)6(9(14)18-5)10-2-1-3-19(15,16)17/h5-14H,1-4H2,(H,15,16,17) |
| InChIKey | PTLPQCJRCAGCHL-UHFFFAOYSA-N |
| XLogP | -3.35 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|