C12H25NO5 — CID 140974837
(3R,4R,5S,6R)-3-(hexylamino)-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 140974837) has the molecular formula C12H25NO5 and a molecular weight of 263.33 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-(hexylamino)-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-3-(hexylamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 140974837 |
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (3R,4R,5S,6R)-3-(hexylamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | CCCCCCN[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H25NO5/c1-2-3-4-5-6-13-9-11(16)10(15)8(7-14)18-12(9)17/h8-17H,2-7H2,1H3/t8-,9-,10-,11-,12?/m1/s1 |
| InChIKey | GUQLUDVYWSUGAL-PRFVCTMUSA-N |
| XLogP | -1.04 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|