C8H17NO5 — CID 70829993
(3R,5S)-3-(ethylamino)-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 70829993) has the molecular formula C8H17NO5 and a molecular weight of 207.23 g/mol. Its IUPAC name is (3R,5S)-3-(ethylamino)-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (3R,5S)-3-(ethylamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 70829993 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (3R,5S)-3-(ethylamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | CCN[C@H]1C(O)OC(CO)[C@@H](O)C1O |
| InChI | InChI=1S/C8H17NO5/c1-2-9-5-7(12)6(11)4(3-10)14-8(5)13/h4-13H,2-3H2,1H3/t4?,5-,6-,7?,8?/m1/s1 |
| InChIKey | CBPKXFJDLCLUHE-DMIPUTKBSA-N |
| XLogP | -2.60 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |