C8H18O7 — CID 167433871
ethanol;(2S,3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 167433871) has the molecular formula C8H18O7 and a molecular weight of 226.22 g/mol. Its IUPAC name is ethanol;(2S,3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | ethanol;(2S,3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 167433871 |
| Molecular Formula | C8H18O7 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | ethanol;(2S,3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CCO.OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6.C2H6O/c7-1-2-3(8)4(9)5(10)6(11)12-2;1-2-3/h2-11H,1H2;3H,2H2,1H3/t2-,3-,4+,5+,6+;/m1./s1 |
| InChIKey | YZQHXBAMMMFOKK-XECIQJBQSA-N |
| XLogP | -3.22 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |