C7H16N2O5 — CID 126608918
(3R,4R,5R)-3-(aminomethylamino)-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 126608918) has the molecular formula C7H16N2O5 and a molecular weight of 208.21 g/mol. Its IUPAC name is (3R,4R,5R)-3-(aminomethylamino)-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (3R,4R,5R)-3-(aminomethylamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 126608918 |
| Molecular Formula | C7H16N2O5 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3R,4R,5R)-3-(aminomethylamino)-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | NCN[C@H]1C(O)OC(CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H16N2O5/c8-2-9-4-6(12)5(11)3(1-10)14-7(4)13/h3-7,9-13H,1-2,8H2/t3?,4-,5+,6-,7?/m1/s1 |
| InChIKey | NBIXMSMUUWJSHS-CXJSFISGSA-N |
| XLogP | -3.71 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|