C7H15NO5 — CID 148734988
(3S)-6-(hydroxymethyl)-3-(methylamino)oxane-2,4,5-triol (PubChem CID 148734988) has the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. Its IUPAC name is (3S)-6-(hydroxymethyl)-3-(methylamino)oxane-2,4,5-triol.
| Compound Name | (3S)-6-(hydroxymethyl)-3-(methylamino)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 148734988 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (3S)-6-(hydroxymethyl)-3-(methylamino)oxane-2,4,5-triol |
| SMILES | CN[C@@H]1C(O)OC(CO)C(O)C1O |
| InChI | InChI=1S/C7H15NO5/c1-8-4-6(11)5(10)3(2-9)13-7(4)12/h3-12H,2H2,1H3/t3?,4-,5?,6?,7?/m0/s1 |
| InChIKey | OBSLWIKITOYASJ-SXULZNNNSA-N |
| XLogP | -2.99 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |