C8H16N2O6 — CID 100567156
1-methyl-3-[(2R,3S,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea (PubChem CID 100567156) has the molecular formula C8H16N2O6 and a molecular weight of 236.22 g/mol. Its IUPAC name is 1-methyl-3-[(2R,3S,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea.
| Compound Name | 1-methyl-3-[(2R,3S,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
|---|---|
| PubChem CID | 100567156 |
| Molecular Formula | C8H16N2O6 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-methyl-3-[(2R,3S,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
| SMILES | CNC(=O)N[C@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C8H16N2O6/c1-9-8(15)10-4-6(13)5(12)3(2-11)16-7(4)14/h3-7,11-14H,2H2,1H3,(H2,9,10,15)/t3-,4+,5+,6-,7-/m1/s1 |
| InChIKey | NMLJYAXJYSFZFG-VOQCIKJUSA-N |
| XLogP | -3.28 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |