C13H30N2O10 — CID 159492637
(2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;(3R,4R,5S,6R)-6-(hydroxymethyl)-3-(methylamino)oxane-2,4,5-triol (PubChem CID 159492637) has the molecular formula C13H30N2O10 and a molecular weight of 374.39 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;(3R,4R,5S,6R)-6-(hydroxymethyl)-3-(methylamino)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;(3R,4R,5S,6R)-6-(hydroxymethyl)-3-(methylamino)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 159492637 |
| Molecular Formula | C13H30N2O10 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (2R,3R,4R,5S)-6-aminohexane-1,2,3,4,5-pentol;(3R,4R,5S,6R)-6-(hydroxymethyl)-3-(methylamino)oxane-2,4,5-triol |
| SMILES | CN[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O.NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15NO5.C6H15NO5/c1-8-4-6(11)5(10)3(2-9)13-7(4)12;7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,2H2,1H3;3-6,8-12H,1-2,7H2/t3-,4-,5-,6-,7?;3-,4+,5+,6+/m10/s1 |
| InChIKey | LYJQRUZLNBHMKS-WNRIFIIBSA-N |
| XLogP | -6.61 |
| TPSA | 229.35 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | -6.61 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |