C18H38O17 — CID 174522135
hexane-1,2,3,4,5,6-hexol;1-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,2,3,4,5,6-hexol (PubChem CID 174522135) has the molecular formula C18H38O17 and a molecular weight of 526.49 g/mol. Its IUPAC name is hexane-1,2,3,4,5,6-hexol;1-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,2,3,4,5,6-hexol.
| Compound Name | hexane-1,2,3,4,5,6-hexol;1-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 174522135 |
| Molecular Formula | C18H38O17 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | hexane-1,2,3,4,5,6-hexol;1-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,2,3,4,5,6-hexol |
| SMILES | OCC(O)C(O)C(O)C(O)C(O)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C12H24O11.C6H14O6/c13-1-3(15)5(16)7(18)9(20)11(22)12-10(21)8(19)6(17)4(2-14)23-12;7-1-3(9)5(11)6(12)4(10)2-8/h3-22H,1-2H2;3-12H,1-2H2/t3?,4-,5?,6-,7?,8+,9?,10-,11?,12?;/m1./s1 |
| InChIKey | GWJKXLVOTBRWNK-YBOZICCVSA-N |
| XLogP | -9.96 |
| TPSA | 332.91 Ų |
| H-Bond Donors | 16 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | -9.96 |
| H-Bond Donors ≤ 5 | 16 |
| H-Bond Acceptors ≤ 10 | 17 |