C10H20O10 — CID 172768726
(2S,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 172768726) has the molecular formula C10H20O10 and a molecular weight of 300.26 g/mol. Its IUPAC name is (2S,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | (2S,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 172768726 |
| Molecular Formula | C10H20O10 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2S,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | O=C[C@H](O)[C@H](O)[C@H](O)CO.OC[C@H]1O[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/2C5H10O5/c6-1-2-3(7)4(8)5(9)10-2;6-1-3(8)5(10)4(9)2-7/h2-9H,1H2;1,3-5,7-10H,2H2/t2-,3-,4-,5+;3-,4+,5-/m10/s1 |
| InChIKey | MQXLQCKGLZJVQF-GAUCNLNESA-N |
| XLogP | -5.32 |
| TPSA | 188.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | -5.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|