C11H22O11 — CID 88608048
cyclohexane-1,2,3,4,5,6-hexol;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 88608048) has the molecular formula C11H22O11 and a molecular weight of 330.29 g/mol. Its IUPAC name is cyclohexane-1,2,3,4,5,6-hexol;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | cyclohexane-1,2,3,4,5,6-hexol;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 88608048 |
| Molecular Formula | C11H22O11 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | cyclohexane-1,2,3,4,5,6-hexol;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | O=C[C@@H](O)[C@H](O)[C@H](O)CO.OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C6H12O6.C5H10O5/c7-1-2(8)4(10)6(12)5(11)3(1)9;6-1-3(8)5(10)4(9)2-7/h1-12H;1,3-5,7-10H,2H2/t;3-,4-,5+/m.1/s1 |
| InChIKey | MYIHAEUZZCCTRR-HUOQAHFNSA-N |
| XLogP | -6.57 |
| TPSA | 219.37 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | -6.57 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|