C10H19ClO9 — CID 70420715
(1S,2S,3S,4R)-1-[(2R,3S,4S,5S)-6-chloro-3,4,5-trihydroxyoxan-2-yl]pentane-1,2,3,4,5-pentol (PubChem CID 70420715) has the molecular formula C10H19ClO9 and a molecular weight of 318.71 g/mol. Its IUPAC name is (1S,2S,3S,4R)-1-[(2R,3S,4S,5S)-6-chloro-3,4,5-trihydroxyoxan-2-yl]pentane-1,2,3,4,5-pentol.
| Compound Name | (1S,2S,3S,4R)-1-[(2R,3S,4S,5S)-6-chloro-3,4,5-trihydroxyoxan-2-yl]pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 70420715 |
| Molecular Formula | C10H19ClO9 |
| Molecular Weight | 318.71 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (1S,2S,3S,4R)-1-[(2R,3S,4S,5S)-6-chloro-3,4,5-trihydroxyoxan-2-yl]pentane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@H](O)[C@H](O)[C@H](O)[C@H]1OC(Cl)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H19ClO9/c11-10-8(19)5(16)7(18)9(20-10)6(17)4(15)3(14)2(13)1-12/h2-10,12-19H,1H2/t2-,3+,4+,5+,6+,7+,8+,9-,10?/m1/s1 |
| InChIKey | BIHOKZKNVXJVKV-MQRUHFSZSA-N |
| XLogP | -4.53 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.71 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|