C9H18O9 — CID 91197418
(3R,4S,5S,6R)-6-[(1R,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxane-2,3,4,5-tetrol (PubChem CID 91197418) has the molecular formula C9H18O9 and a molecular weight of 270.23 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-[(1R,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6R)-6-[(1R,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 91197418 |
| Molecular Formula | C9H18O9 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (3R,4S,5S,6R)-6-[(1R,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxane-2,3,4,5-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H](O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H18O9/c10-1-2(11)3(12)5(14)8-6(15)4(13)7(16)9(17)18-8/h2-17H,1H2/t2-,3-,4+,5-,6+,7-,8-,9?/m1/s1 |
| InChIKey | JFEBLWKYMNUVDT-GDCSISPOSA-N |
| XLogP | -5.14 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | -5.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |