C7H14O7 — CID 67823819
(3S,4R,5R)-5-[(1R,2R)-1,2,3-trihydroxypropyl]oxolane-2,3,4-triol (PubChem CID 67823819) has the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. Its IUPAC name is (3S,4R,5R)-5-[(1R,2R)-1,2,3-trihydroxypropyl]oxolane-2,3,4-triol.
| Compound Name | (3S,4R,5R)-5-[(1R,2R)-1,2,3-trihydroxypropyl]oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 67823819 |
| Molecular Formula | C7H14O7 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (3S,4R,5R)-5-[(1R,2R)-1,2,3-trihydroxypropyl]oxolane-2,3,4-triol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H]1OC(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H14O7/c8-1-2(9)3(10)6-4(11)5(12)7(13)14-6/h2-13H,1H2/t2-,3-,4-,5+,6-,7?/m1/s1 |
| InChIKey | FEPIQWDROKRXHM-OLWSXQJJSA-N |
| XLogP | -3.86 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |