C24H48O22 — CID 160747634
6-[(2S,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4,5-pentol (PubChem CID 160747634) has the molecular formula C24H48O22 and a molecular weight of 688.63 g/mol. Its IUPAC name is 6-[(2S,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4,5-pentol.
| Compound Name | 6-[(2S,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 160747634 |
| Molecular Formula | C24H48O22 |
| Molecular Weight | 688.63 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | 6-[(2S,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4,5-pentol |
| SMILES | OCC(O)C(O)C(O)C(O)CO[C@H]1OC(CO)[C@@H](O)[C@@H](O)C1O.OCC(O)C(O)C(O)C(O)CO[C@H]1OC(CO)[C@@H](O)[C@@H](O)C1O |
| InChI | InChI=1S/2C12H24O11/c2*13-1-4(15)7(17)8(18)5(16)3-22-12-11(21)10(20)9(19)6(2-14)23-12/h2*4-21H,1-3H2/t2*4?,5?,6?,7?,8?,9-,10-,11?,12+/m11/s1 |
| InChIKey | RWJWQKXVEITNKS-OIORIRLGSA-N |
| XLogP | -11.52 |
| TPSA | 401.06 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.63 |
| LogP ≤ 5 | -11.52 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 22 |