C13H26O10 — CID 164799894
(3R,4R)-1-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptane-2,3,4,5-tetrol (PubChem CID 164799894) has the molecular formula C13H26O10 and a molecular weight of 342.34 g/mol. Its IUPAC name is (3R,4R)-1-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptane-2,3,4,5-tetrol.
| Compound Name | (3R,4R)-1-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 164799894 |
| Molecular Formula | C13H26O10 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (3R,4R)-1-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptane-2,3,4,5-tetrol |
| SMILES | CCC(O)[C@@H](O)[C@H](O)C(O)CO[C@H]1OC(CO)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C13H26O10/c1-2-5(15)8(17)9(18)6(16)4-22-13-12(21)11(20)10(19)7(3-14)23-13/h5-21H,2-4H2,1H3/t5?,6?,7?,8-,9-,10+,11+,12?,13+/m1/s1 |
| InChIKey | SGAMWIOLMXCZQX-PPGAWPFNSA-N |
| XLogP | -4.34 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |