C18H34O16 — CID 91861684
(2R,3R,4R,5R)-3,6-bis[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]hexane-1,2,4,5-tetrol (PubChem CID 91861684) has the molecular formula C18H34O16 and a molecular weight of 506.45 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3,6-bis[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]hexane-1,2,4,5-tetrol.
| Compound Name | (2R,3R,4R,5R)-3,6-bis[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]hexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 91861684 |
| Molecular Formula | C18H34O16 |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | (2R,3R,4R,5R)-3,6-bis[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]hexane-1,2,4,5-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)[C@H](O)[C@H](O)CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H34O16/c19-1-5(22)16(34-18-15(30)13(28)11(26)8(3-21)33-18)9(24)6(23)4-31-17-14(29)12(27)10(25)7(2-20)32-17/h5-30H,1-4H2/t5-,6-,7-,8-,9-,10-,11-,12+,13+,14+,15+,16-,17+,18-/m1/s1 |
| InChIKey | MBQGGWXTVOGNOW-UIMXQNPSSA-N |
| XLogP | -7.94 |
| TPSA | 279.68 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | -7.94 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |