C11H22O10 — CID 121434245
(2S,4R)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentane-1,2,4,5-tetrol (PubChem CID 121434245) has the molecular formula C11H22O10 and a molecular weight of 314.29 g/mol. Its IUPAC name is (2S,4R)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentane-1,2,4,5-tetrol.
| Compound Name | (2S,4R)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 121434245 |
| Molecular Formula | C11H22O10 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2S,4R)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentane-1,2,4,5-tetrol |
| SMILES | OC[C@@H](O)C(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@@H](O)CO |
| InChI | InChI=1S/C11H22O10/c12-1-4(15)10(5(16)2-13)21-11-9(19)8(18)7(17)6(3-14)20-11/h4-19H,1-3H2/t4-,5+,6-,7-,8+,9-,10?,11-/m1/s1 |
| InChIKey | SCXGNCOUPCBZEE-MLLSXUACSA-N |
| XLogP | -5.12 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -5.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |