C11H22O9 — CID 18639325
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1,2,4-trihydroxypentan-3-yloxy)oxane-3,4,5-triol (PubChem CID 18639325) has the molecular formula C11H22O9 and a molecular weight of 298.29 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1,2,4-trihydroxypentan-3-yloxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1,2,4-trihydroxypentan-3-yloxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 18639325 |
| Molecular Formula | C11H22O9 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-(1,2,4-trihydroxypentan-3-yloxy)oxane-3,4,5-triol |
| SMILES | CC(O)C(OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(O)CO |
| InChI | InChI=1S/C11H22O9/c1-4(14)10(5(15)2-12)20-11-9(18)8(17)7(16)6(3-13)19-11/h4-18H,2-3H2,1H3/t4?,5?,6-,7-,8+,9-,10?,11?/m1/s1 |
| InChIKey | PBMIGTSRGPICNP-BQOWCMLDSA-N |
| XLogP | -4.09 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |