C12H24O10 — CID 147102507
(2R,3S,4R,5S)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol (PubChem CID 147102507) has the molecular formula C12H24O10 and a molecular weight of 328.31 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol.
| Compound Name | (2R,3S,4R,5S)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 147102507 |
| Molecular Formula | C12H24O10 |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2R,3S,4R,5S)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)CO |
| InChI | InChI=1S/C12H24O10/c1-4(15)7(17)11(5(16)2-13)22-12-10(20)9(19)8(18)6(3-14)21-12/h4-20H,2-3H2,1H3/t4-,5+,6+,7+,8+,9-,10+,11-,12+/m0/s1 |
| InChIKey | BKXUHEXKVCCPIX-JUUDDBOJSA-N |
| XLogP | -4.73 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |