C6H15NO5 — CID 22863347
(2R,3S,4S,5R)-6-aminohexane-1,2,3,4,5-pentol (PubChem CID 22863347) has the molecular formula C6H15NO5 and a molecular weight of 181.19 g/mol. Its IUPAC name is (2R,3S,4S,5R)-6-aminohexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3S,4S,5R)-6-aminohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 22863347 |
| Molecular Formula | C6H15NO5 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | (2R,3S,4S,5R)-6-aminohexane-1,2,3,4,5-pentol |
| SMILES | NC[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H15NO5/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6,8-12H,1-2,7H2/t3-,4-,5+,6+/m1/s1 |
| InChIKey | SDOFMBGMRVAJNF-ZXXMMSQZSA-N |
| XLogP | -3.62 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |