C4H11NO3 — CID 25150845
(2R,3R)-4-aminobutane-1,2,3-triol (PubChem CID 25150845) has the molecular formula C4H11NO3 and a molecular weight of 121.14 g/mol. Its IUPAC name is (2R,3R)-4-aminobutane-1,2,3-triol.
| Compound Name | (2R,3R)-4-aminobutane-1,2,3-triol |
|---|---|
| PubChem CID | 25150845 |
| Molecular Formula | C4H11NO3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | (2R,3R)-4-aminobutane-1,2,3-triol |
| SMILES | NC[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H11NO3/c5-1-3(7)4(8)2-6/h3-4,6-8H,1-2,5H2/t3-,4-/m1/s1 |
| InChIKey | WIFPJDJJFUSIFP-QWWZWVQMSA-N |
| XLogP | -2.34 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |