About CID 175818048
CID 175818048 (PubChem CID 175818048) has the molecular formula C3H7BO3
and a molecular weight of 101.90 g/mol.
Molecular Properties
| Compound Name | CID 175818048 |
| PubChem CID | 175818048 |
| Molecular Formula | C3H7BO3 |
| Molecular Weight | 101.90 g/mol |
| Exact Mass | 102.05 |
| IUPAC Name | — |
| SMILES | [B]C(O)C(O)CO |
| InChI | InChI=1S/C3H7BO3/c4-3(7)2(6)1-5/h2-3,5-7H,1H2 |
| InChIKey | UXLHTJANZTVNKP-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.90 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175818048 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175818048?
The IUPAC name of CID 175818048 (CID 175818048) is not available.
What is the SMILES notation for CID 175818048?
The canonical SMILES for CID 175818048 is [B]C(O)C(O)CO.
What is the InChIKey of CID 175818048?
The InChIKey is UXLHTJANZTVNKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7BO3/c4-3(7)2(6)1-5/h2-3,5-7H,1H2.
What are the key properties of CID 175818048?
CID 175818048 has a molecular weight of 101.90 g/mol, XLogP of -2.17, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175818048 is sourced from PubChem (CID 175818048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).