C3H9ClO4 — CID 141440850
1-chloropropane-1,2,3-triol;hydrate (PubChem CID 141440850) has the molecular formula C3H9ClO4 and a molecular weight of 144.55 g/mol. Its IUPAC name is 1-chloropropane-1,2,3-triol;hydrate.
| Compound Name | 1-chloropropane-1,2,3-triol;hydrate |
|---|---|
| PubChem CID | 141440850 |
| Molecular Formula | C3H9ClO4 |
| Molecular Weight | 144.55 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | 1-chloropropane-1,2,3-triol;hydrate |
| SMILES | O.OCC(O)C(O)Cl |
| InChI | InChI=1S/C3H7ClO3.H2O/c4-3(7)2(6)1-5;/h2-3,5-7H,1H2;1H2 |
| InChIKey | BZVUNCYCFSLKSN-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.55 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|